C25H24N2O13 — CID 169274255
bis[2-[(5-methyl-2-oxo-1,3-dioxan-4-yl)methyl]-4-nitrophenyl] carbonate (PubChem CID 169274255) has the molecular formula C25H24N2O13 and a molecular weight of 560.47 g/mol. Its IUPAC name is bis[2-[(5-methyl-2-oxo-1,3-dioxan-4-yl)methyl]-4-nitrophenyl] carbonate.
| Compound Name | bis[2-[(5-methyl-2-oxo-1,3-dioxan-4-yl)methyl]-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 169274255 |
| Molecular Formula | C25H24N2O13 |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | bis[2-[(5-methyl-2-oxo-1,3-dioxan-4-yl)methyl]-4-nitrophenyl] carbonate |
| SMILES | CC1COC(=O)OC1Cc1cc([N+](=O)[O-])ccc1OC(=O)Oc1ccc([N+](=O)[O-])cc1CC1OC(=O)OCC1C |
| InChI | InChI=1S/C25H24N2O13/c1-13-11-35-23(28)39-21(13)9-15-7-17(26(31)32)3-5-19(15)37-25(30)38-20-6-4-18(27(33)34)8-16(20)10-22-14(2)12-36-24(29)40-22/h3-8,13-14,21-22H,9-12H2,1-2H3 |
| InChIKey | ZLGOQBFDJKPBNK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 192.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|