C16H20N6O3S — CID 166061036
[4-[[[6-(ethylamino)-1-methylpyrazolo[5,4-b]pyridin-4-yl]amino]methyl]phenyl]sulfamic acid (PubChem CID 166061036) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is [4-[[[6-(ethylamino)-1-methylpyrazolo[5,4-b]pyridin-4-yl]amino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[[6-(ethylamino)-1-methylpyrazolo[5,4-b]pyridin-4-yl]amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 166061036 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [4-[[[6-(ethylamino)-1-methylpyrazolo[5,4-b]pyridin-4-yl]amino]methyl]phenyl]sulfamic acid |
| SMILES | CCNc1cc(NCc2ccc(NS(=O)(=O)O)cc2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C16H20N6O3S/c1-3-17-15-8-14(13-10-19-22(2)16(13)20-15)18-9-11-4-6-12(7-5-11)21-26(23,24)25/h4-8,10,21H,3,9H2,1-2H3,(H2,17,18,20)(H,23,24,25) |
| InChIKey | IAKIHCABDQEHDU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|