C19H18N6O3S — CID 166060851
[4-[[(1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid (PubChem CID 166060851) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is [4-[[(1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[(1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 166060851 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [4-[[(1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid |
| SMILES | Cn1nc(-c2ccccc2)c2c(NCc3ccc(NS(=O)(=O)O)cc3)ncnc21 |
| InChI | InChI=1S/C19H18N6O3S/c1-25-19-16(17(23-25)14-5-3-2-4-6-14)18(21-12-22-19)20-11-13-7-9-15(10-8-13)24-29(26,27)28/h2-10,12,24H,11H2,1H3,(H,20,21,22)(H,26,27,28) |
| InChIKey | ZCMOACVNNCUPTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|