C21H21N5O3S2 — CID 166060928
[4-[[[2-(dimethylamino)-5-phenylthieno[2,3-d]pyrimidin-4-yl]amino]methyl]phenyl]sulfamic acid (PubChem CID 166060928) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is [4-[[[2-(dimethylamino)-5-phenylthieno[2,3-d]pyrimidin-4-yl]amino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[[2-(dimethylamino)-5-phenylthieno[2,3-d]pyrimidin-4-yl]amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 166060928 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [4-[[[2-(dimethylamino)-5-phenylthieno[2,3-d]pyrimidin-4-yl]amino]methyl]phenyl]sulfamic acid |
| SMILES | CN(C)c1nc(NCc2ccc(NS(=O)(=O)O)cc2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C21H21N5O3S2/c1-26(2)21-23-19(22-12-14-8-10-16(11-9-14)25-31(27,28)29)18-17(13-30-20(18)24-21)15-6-4-3-5-7-15/h3-11,13,25H,12H2,1-2H3,(H,22,23,24)(H,27,28,29) |
| InChIKey | FWJYZKLGYPPZNM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|