C19H17ClN6O3S — CID 166060886
[4-[[(6-chloro-1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid (PubChem CID 166060886) has the molecular formula C19H17ClN6O3S and a molecular weight of 444.90 g/mol. Its IUPAC name is [4-[[(6-chloro-1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[(6-chloro-1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 166060886 |
| Molecular Formula | C19H17ClN6O3S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [4-[[(6-chloro-1-methyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid |
| SMILES | Cn1nc(-c2ccccc2)c2c(NCc3ccc(NS(=O)(=O)O)cc3)nc(Cl)nc21 |
| InChI | InChI=1S/C19H17ClN6O3S/c1-26-18-15(16(24-26)13-5-3-2-4-6-13)17(22-19(20)23-18)21-11-12-7-9-14(10-8-12)25-30(27,28)29/h2-10,25H,11H2,1H3,(H,21,22,23)(H,27,28,29) |
| InChIKey | ZIATUYPJQHFYBB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|