C14H15BrN6O3S — CID 166060966
[4-[[(3-bromo-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid (PubChem CID 166060966) has the molecular formula C14H15BrN6O3S and a molecular weight of 427.28 g/mol. Its IUPAC name is [4-[[(3-bromo-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[(3-bromo-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 166060966 |
| Molecular Formula | C14H15BrN6O3S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | [4-[[(3-bromo-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)amino]methyl]phenyl]sulfamic acid |
| SMILES | Cc1nc(NCc2ccc(NS(=O)(=O)O)cc2)c2c(Br)nn(C)c2n1 |
| InChI | InChI=1S/C14H15BrN6O3S/c1-8-17-13(11-12(15)19-21(2)14(11)18-8)16-7-9-3-5-10(6-4-9)20-25(22,23)24/h3-6,20H,7H2,1-2H3,(H,16,17,18)(H,22,23,24) |
| InChIKey | XPLPLLBAUSFABI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|