C30H39BrN4O6S — CID 166061522
ethyl 3-[1-(6-bromohexyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate (PubChem CID 166061522) has the molecular formula C30H39BrN4O6S and a molecular weight of 663.63 g/mol. Its IUPAC name is ethyl 3-[1-(6-bromohexyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate.
| Compound Name | ethyl 3-[1-(6-bromohexyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 166061522 |
| Molecular Formula | C30H39BrN4O6S |
| Molecular Weight | 663.63 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | ethyl 3-[1-(6-bromohexyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C)c([C@@H](C)N2CC=C(O)OS2(=O)=O)c1)c1ccc2c(nnn2CCCCCCBr)c1C |
| InChI | InChI=1S/C30H39BrN4O6S/c1-5-40-29(37)19-26(24-12-13-27-30(21(24)3)32-33-34(27)16-9-7-6-8-15-31)23-11-10-20(2)25(18-23)22(4)35-17-14-28(36)41-42(35,38)39/h10-14,18,22,26,36H,5-9,15-17,19H2,1-4H3/t22-,26?/m1/s1 |
| InChIKey | IRLQLQCGTKIFEG-FPSALIRRSA-N |
| XLogP | 6.13 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|