C26H30BrClN4O6S — CID 166061650
ethyl 3-[1-(4-bromobutyl)-4-methylbenzotriazol-5-yl]-3-[4-chloro-3-[(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]phenyl]propanoate (PubChem CID 166061650) has the molecular formula C26H30BrClN4O6S and a molecular weight of 641.97 g/mol. Its IUPAC name is ethyl 3-[1-(4-bromobutyl)-4-methylbenzotriazol-5-yl]-3-[4-chloro-3-[(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]phenyl]propanoate.
| Compound Name | ethyl 3-[1-(4-bromobutyl)-4-methylbenzotriazol-5-yl]-3-[4-chloro-3-[(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 166061650 |
| Molecular Formula | C26H30BrClN4O6S |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | ethyl 3-[1-(4-bromobutyl)-4-methylbenzotriazol-5-yl]-3-[4-chloro-3-[(6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]phenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(Cl)c(CN2CC=C(O)OS2(=O)=O)c1)c1ccc2c(nnn2CCCCBr)c1C |
| InChI | InChI=1S/C26H30BrClN4O6S/c1-3-37-25(34)15-21(20-7-9-23-26(17(20)2)29-30-32(23)12-5-4-11-27)18-6-8-22(28)19(14-18)16-31-13-10-24(33)38-39(31,35)36/h6-10,14,21,33H,3-5,11-13,15-16H2,1-2H3 |
| InChIKey | YXAABQGZGYIDJE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|