C33H39BrN4O6S — CID 166172785
ethyl 3-[1-(5-bromopentyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-1,2λ6,3-benzoxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate (PubChem CID 166172785) has the molecular formula C33H39BrN4O6S and a molecular weight of 699.67 g/mol. Its IUPAC name is ethyl 3-[1-(5-bromopentyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-1,2λ6,3-benzoxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate.
| Compound Name | ethyl 3-[1-(5-bromopentyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-1,2λ6,3-benzoxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 166172785 |
| Molecular Formula | C33H39BrN4O6S |
| Molecular Weight | 699.67 g/mol |
| Exact Mass | 698.18 |
| IUPAC Name | ethyl 3-[1-(5-bromopentyl)-4-methylbenzotriazol-5-yl]-3-[3-[(1R)-1-(6-hydroxy-2,2-dioxo-4H-1,2λ6,3-benzoxathiazin-3-yl)ethyl]-4-methylphenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C)c([C@@H](C)N2Cc3cc(O)ccc3OS2(=O)=O)c1)c1ccc2c(nnn2CCCCCBr)c1C |
| InChI | InChI=1S/C33H39BrN4O6S/c1-5-43-32(40)19-29(27-12-13-30-33(22(27)3)35-36-37(30)16-8-6-7-15-34)24-10-9-21(2)28(18-24)23(4)38-20-25-17-26(39)11-14-31(25)44-45(38,41)42/h9-14,17-18,23,29,39H,5-8,15-16,19-20H2,1-4H3/t23-,29?/m1/s1 |
| InChIKey | XIRUHHCBJSXZJQ-WIZGVZBGSA-N |
| XLogP | 6.60 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|