C27H32Cl2N4O6S — CID 166061718
ethyl 3-[1-(4-chlorobutyl)-4-methylbenzotriazol-5-yl]-3-[3-[(5-chloro-6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]-4-methylphenyl]propanoate (PubChem CID 166061718) has the molecular formula C27H32Cl2N4O6S and a molecular weight of 611.55 g/mol. Its IUPAC name is ethyl 3-[1-(4-chlorobutyl)-4-methylbenzotriazol-5-yl]-3-[3-[(5-chloro-6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]-4-methylphenyl]propanoate.
| Compound Name | ethyl 3-[1-(4-chlorobutyl)-4-methylbenzotriazol-5-yl]-3-[3-[(5-chloro-6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 166061718 |
| Molecular Formula | C27H32Cl2N4O6S |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | ethyl 3-[1-(4-chlorobutyl)-4-methylbenzotriazol-5-yl]-3-[3-[(5-chloro-6-hydroxy-2,2-dioxo-4H-oxathiazin-3-yl)methyl]-4-methylphenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C)c(CN2CC(Cl)=C(O)OS2(=O)=O)c1)c1ccc2c(nnn2CCCCCl)c1C |
| InChI | InChI=1S/C27H32Cl2N4O6S/c1-4-38-25(34)14-22(21-9-10-24-26(18(21)3)30-31-33(24)12-6-5-11-28)19-8-7-17(2)20(13-19)15-32-16-23(29)27(35)39-40(32,36)37/h7-10,13,22,35H,4-6,11-12,14-16H2,1-3H3 |
| InChIKey | KZNWRRJOFUQTAZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|