C17H30N2O — CID 166061927
2'-heptylspiro[5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3,1'-cyclopentane]-1-one (PubChem CID 166061927) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 2'-heptylspiro[5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3,1'-cyclopentane]-1-one.
| Compound Name | 2'-heptylspiro[5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3,1'-cyclopentane]-1-one |
|---|---|
| PubChem CID | 166061927 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2'-heptylspiro[5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3,1'-cyclopentane]-1-one |
| SMILES | CCCCCCCC1CCCC12NC(=O)C1CCCN12 |
| InChI | InChI=1S/C17H30N2O/c1-2-3-4-5-6-9-14-10-7-12-17(14)18-16(20)15-11-8-13-19(15)17/h14-15H,2-13H2,1H3,(H,18,20) |
| InChIKey | YOWMYHACCBYKMR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|