C15H7Cl3FN — CID 166064932
(Z)-2-(5-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)prop-2-enenitrile (PubChem CID 166064932) has the molecular formula C15H7Cl3FN and a molecular weight of 326.59 g/mol. Its IUPAC name is (Z)-2-(5-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(5-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 166064932 |
| Molecular Formula | C15H7Cl3FN |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | (Z)-2-(5-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc(Cl)c1Cl)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H7Cl3FN/c16-11-4-5-14(19)12(7-11)10(8-20)6-9-2-1-3-13(17)15(9)18/h1-7H/b10-6+ |
| InChIKey | SUSUOYMFSMPXTJ-UXBLZVDNSA-N |
| XLogP | 5.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|