C18H9Cl2FN2S — CID 7121360
(Z)-3-(2,3-dichlorophenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 7121360) has the molecular formula C18H9Cl2FN2S and a molecular weight of 375.26 g/mol. Its IUPAC name is (Z)-3-(2,3-dichlorophenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2,3-dichlorophenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 7121360 |
| Molecular Formula | C18H9Cl2FN2S |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | (Z)-3-(2,3-dichlorophenyl)-2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cccc(Cl)c1Cl)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C18H9Cl2FN2S/c19-15-3-1-2-12(17(15)20)8-13(9-22)18-23-16(10-24-18)11-4-6-14(21)7-5-11/h1-8,10H/b13-8- |
| InChIKey | IXSSRNXWRUABCH-JYRVWZFOSA-N |
| XLogP | 6.32 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|