C12H25NO6S — CID 166071250
(2,3-dimethyl-5-prop-2-enoyloxypentan-2-yl) sulfate;ethylazanium (PubChem CID 166071250) has the molecular formula C12H25NO6S and a molecular weight of 311.40 g/mol. Its IUPAC name is (2,3-dimethyl-5-prop-2-enoyloxypentan-2-yl) sulfate;ethylazanium.
| Compound Name | (2,3-dimethyl-5-prop-2-enoyloxypentan-2-yl) sulfate;ethylazanium |
|---|---|
| PubChem CID | 166071250 |
| Molecular Formula | C12H25NO6S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2,3-dimethyl-5-prop-2-enoyloxypentan-2-yl) sulfate;ethylazanium |
| SMILES | C=CC(=O)OCCC(C)C(C)(C)OS(=O)(=O)[O-].CC[NH3+] |
| InChI | InChI=1S/C10H18O6S.C2H7N/c1-5-9(11)15-7-6-8(2)10(3,4)16-17(12,13)14;1-2-3/h5,8H,1,6-7H2,2-4H3,(H,12,13,14);2-3H2,1H3 |
| InChIKey | DEXFOIKNMFBDEH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|