C9H19NO6S — CID 141149083
azanium (2-methyl-5-prop-2-enoyloxypentan-2-yl) sulfate (PubChem CID 141149083) has the molecular formula C9H19NO6S and a molecular weight of 269.32 g/mol. Its IUPAC name is azanium (2-methyl-5-prop-2-enoyloxypentan-2-yl) sulfate.
| Compound Name | azanium (2-methyl-5-prop-2-enoyloxypentan-2-yl) sulfate |
|---|---|
| PubChem CID | 141149083 |
| Molecular Formula | C9H19NO6S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | azanium (2-methyl-5-prop-2-enoyloxypentan-2-yl) sulfate |
| SMILES | C=CC(=O)OCCCC(C)(C)OS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C9H16O6S.H3N/c1-4-8(10)14-7-5-6-9(2,3)15-16(11,12)13;/h4H,1,5-7H2,2-3H3,(H,11,12,13);1H3 |
| InChIKey | FTHAAPVKEHMFHG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|