C18H30F3NOSi- — CID 166073038
CID 166073038 (PubChem CID 166073038) has the molecular formula C18H30F3NOSi- and a molecular weight of 361.52 g/mol.
| Compound Name | CID 166073038 |
|---|---|
| PubChem CID | 166073038 |
| Molecular Formula | C18H30F3NOSi- |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | — |
| SMILES | CCC(O[Si-](CC)(CC)CC)C(F)(F)c1cccc([C@@H](C)N)c1F |
| InChI | InChI=1S/C18H30F3NOSi/c1-6-16(23-24(7-2,8-3)9-4)18(20,21)15-12-10-11-14(13(5)22)17(15)19/h10-13,16H,6-9,22H2,1-5H3/q-1/t13-,16?/m1/s1 |
| InChIKey | UBHVJMNQZSQLTP-JBZHPUCOSA-N |
| XLogP | 5.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|