C13H18F3NO — CID 166147556
5-[3-(1-aminoethyl)-2-fluorophenyl]-5,5-difluoropentan-1-ol (PubChem CID 166147556) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 5-[3-(1-aminoethyl)-2-fluorophenyl]-5,5-difluoropentan-1-ol.
| Compound Name | 5-[3-(1-aminoethyl)-2-fluorophenyl]-5,5-difluoropentan-1-ol |
|---|---|
| PubChem CID | 166147556 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-[3-(1-aminoethyl)-2-fluorophenyl]-5,5-difluoropentan-1-ol |
| SMILES | CC(N)c1cccc(C(F)(F)CCCCO)c1F |
| InChI | InChI=1S/C13H18F3NO/c1-9(17)10-5-4-6-11(12(10)14)13(15,16)7-2-3-8-18/h4-6,9,18H,2-3,7-8,17H2,1H3 |
| InChIKey | MLGQEKXSCCRPME-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|