C15H14ClIN2O5S2 — CID 166075254
4-[[5-iodo-2-[methyl(methylsulfonyl)amino]benzoyl]amino]benzenesulfonyl chloride (PubChem CID 166075254) has the molecular formula C15H14ClIN2O5S2 and a molecular weight of 528.78 g/mol. Its IUPAC name is 4-[[5-iodo-2-[methyl(methylsulfonyl)amino]benzoyl]amino]benzenesulfonyl chloride.
| Compound Name | 4-[[5-iodo-2-[methyl(methylsulfonyl)amino]benzoyl]amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 166075254 |
| Molecular Formula | C15H14ClIN2O5S2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 527.91 |
| IUPAC Name | 4-[[5-iodo-2-[methyl(methylsulfonyl)amino]benzoyl]amino]benzenesulfonyl chloride |
| SMILES | CN(c1ccc(I)cc1C(=O)Nc1ccc(S(=O)(=O)Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H14ClIN2O5S2/c1-19(25(2,21)22)14-8-3-10(17)9-13(14)15(20)18-11-4-6-12(7-5-11)26(16,23)24/h3-9H,1-2H3,(H,18,20) |
| InChIKey | QPRXXRPQNCASRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|