About cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide
cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide (PubChem CID 166076220) has the molecular formula C26H33N3O
and a molecular weight of 403.57 g/mol. Its IUPAC name is cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide |
| PubChem CID | 166076220 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(=Cc2cccc(N3CCCC3)c2)CC1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C17H23N3O.C9H10/c18-17(21)20-10-6-14(7-11-20)12-15-4-3-5-16(13-15)19-8-1-2-9-19;1-2-4-8(5-3-1)9-6-7-9/h3-5,12-13H,1-2,6-11H2,(H2,18,21);1-5,9H,6-7H2 |
| InChIKey | GNVXZBMGIMSMGS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide?
The IUPAC name of cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide (CID 166076220) is cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide.
What is the SMILES notation for cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide?
The canonical SMILES for cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide is NC(=O)N1CCC(=Cc2cccc(N3CCCC3)c2)CC1.c1ccc(C2CC2)cc1.
What is the InChIKey of cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide?
The InChIKey is GNVXZBMGIMSMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O.C9H10/c18-17(21)20-10-6-14(7-11-20)12-15-4-3-5-16(13-15)19-8-1-2-9-19;1-2-4-8(5-3-1)9-6-7-9/h3-5,12-13H,1-2,6-11H2,(H2,18,21);1-5,9H,6-7H2.
What are the key properties of cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide?
cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide has a molecular weight of 403.57 g/mol, XLogP of 5.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylbenzene;4-[(3-pyrrolidin-1-ylphenyl)methylidene]piperidine-1-carboxamide is sourced from PubChem (CID 166076220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).