C12H22INO — CID 166077704
[3-(3,3,4-trimethylpiperidin-1-yl)cyclobutyl] hypoiodite (PubChem CID 166077704) has the molecular formula C12H22INO and a molecular weight of 323.22 g/mol. Its IUPAC name is [3-(3,3,4-trimethylpiperidin-1-yl)cyclobutyl] hypoiodite.
| Compound Name | [3-(3,3,4-trimethylpiperidin-1-yl)cyclobutyl] hypoiodite |
|---|---|
| PubChem CID | 166077704 |
| Molecular Formula | C12H22INO |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [3-(3,3,4-trimethylpiperidin-1-yl)cyclobutyl] hypoiodite |
| SMILES | CC1CCN(C2CC(OI)C2)CC1(C)C |
| InChI | InChI=1S/C12H22INO/c1-9-4-5-14(8-12(9,2)3)10-6-11(7-10)15-13/h9-11H,4-8H2,1-3H3 |
| InChIKey | KQIPDRIQTKRXDH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|