C12H23N — CID 171846999
(4R)-1-cyclobutyl-3,3,4-trimethylpiperidine (PubChem CID 171846999) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (4R)-1-cyclobutyl-3,3,4-trimethylpiperidine.
| Compound Name | (4R)-1-cyclobutyl-3,3,4-trimethylpiperidine |
|---|---|
| PubChem CID | 171846999 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (4R)-1-cyclobutyl-3,3,4-trimethylpiperidine |
| SMILES | C[C@@H]1CCN(C2CCC2)CC1(C)C |
| InChI | InChI=1S/C12H23N/c1-10-7-8-13(9-12(10,2)3)11-5-4-6-11/h10-11H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | DBZQMWKJJASQGT-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |