C12H25NO — CID 171846998
(4R)-1-cyclobutyl-3,3,4-trimethylpiperidine;hydrate (PubChem CID 171846998) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (4R)-1-cyclobutyl-3,3,4-trimethylpiperidine;hydrate.
| Compound Name | (4R)-1-cyclobutyl-3,3,4-trimethylpiperidine;hydrate |
|---|---|
| PubChem CID | 171846998 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (4R)-1-cyclobutyl-3,3,4-trimethylpiperidine;hydrate |
| SMILES | C[C@@H]1CCN(C2CCC2)CC1(C)C.O |
| InChI | InChI=1S/C12H23N.H2O/c1-10-7-8-13(9-12(10,2)3)11-5-4-6-11;/h10-11H,4-9H2,1-3H3;1H2/t10-;/m1./s1 |
| InChIKey | MFHCOZBKIIVLAZ-HNCPQSOCSA-N |
| XLogP | 2.08 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |