About [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite
[3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite (PubChem CID 166077766) has the molecular formula C9H18IN2O+
and a molecular weight of 297.16 g/mol. Its IUPAC name is [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite.
Molecular Properties
| Compound Name | [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite |
| PubChem CID | 166077766 |
| Molecular Formula | C9H18IN2O+ |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite |
| SMILES | IOC1CC(N2CCC[NH2+]CC2)C1 |
| InChI | InChI=1S/C9H17IN2O/c10-13-9-6-8(7-9)12-4-1-2-11-3-5-12/h8-9,11H,1-7H2/p+1 |
| InChIKey | NXAXBMGDWBDFPN-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 29.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite?
The IUPAC name of [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite (CID 166077766) is [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite.
What is the SMILES notation for [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite?
The canonical SMILES for [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite is IOC1CC(N2CCC[NH2+]CC2)C1.
What is the InChIKey of [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite?
The InChIKey is NXAXBMGDWBDFPN-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17IN2O/c10-13-9-6-8(7-9)12-4-1-2-11-3-5-12/h8-9,11H,1-7H2/p+1.
What are the key properties of [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite?
[3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite has a molecular weight of 297.16 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,4-diazepan-4-ium-1-yl)cyclobutyl] hypoiodite is sourced from PubChem (CID 166077766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).