C11H19F2NO — CID 166078022
3,3-difluoro-1-(3-methoxycyclobutyl)-4-methylpiperidine (PubChem CID 166078022) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is 3,3-difluoro-1-(3-methoxycyclobutyl)-4-methylpiperidine.
| Compound Name | 3,3-difluoro-1-(3-methoxycyclobutyl)-4-methylpiperidine |
|---|---|
| PubChem CID | 166078022 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3,3-difluoro-1-(3-methoxycyclobutyl)-4-methylpiperidine |
| SMILES | COC1CC(N2CCC(C)C(F)(F)C2)C1 |
| InChI | InChI=1S/C11H19F2NO/c1-8-3-4-14(7-11(8,12)13)9-5-10(6-9)15-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | UWVRUWRPQLNFIU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |