C48H99NO4S — CID 166078470
ethane;heptadecan-9-yl 7-hydroxy-8-[(2-hydroxy-9-methylhexadecyl)-(4-sulfanylbutyl)amino]octanoate (PubChem CID 166078470) has the molecular formula C48H99NO4S and a molecular weight of 786.39 g/mol. Its IUPAC name is ethane;heptadecan-9-yl 7-hydroxy-8-[(2-hydroxy-9-methylhexadecyl)-(4-sulfanylbutyl)amino]octanoate.
| Compound Name | ethane;heptadecan-9-yl 7-hydroxy-8-[(2-hydroxy-9-methylhexadecyl)-(4-sulfanylbutyl)amino]octanoate |
|---|---|
| PubChem CID | 166078470 |
| Molecular Formula | C48H99NO4S |
| Molecular Weight | 786.39 g/mol |
| Exact Mass | 785.73 |
| IUPAC Name | ethane;heptadecan-9-yl 7-hydroxy-8-[(2-hydroxy-9-methylhexadecyl)-(4-sulfanylbutyl)amino]octanoate |
| SMILES | CC.CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCC(O)CN(CCCCS)CC(O)CCCCCCC(C)CCCCCCC |
| InChI | InChI=1S/C46H93NO4S.C2H6/c1-5-8-11-14-17-26-35-45(36-27-18-15-12-9-6-2)51-46(50)37-28-21-25-34-44(49)41-47(38-29-30-39-52)40-43(48)33-24-20-19-23-32-42(4)31-22-16-13-10-7-3;1-2/h42-45,48-49,52H,5-41H2,1-4H3;1-2H3 |
| InChIKey | CNFMITYSINVFBE-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.39 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|