C28H21N3O2 — CID 16608225
(1,3-diphenylpyrazol-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608225) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608225 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1cccc2cccnc12)OCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H21N3O2/c32-26(17-16-23-12-7-11-21-13-8-18-29-27(21)23)33-20-24-19-31(25-14-5-2-6-15-25)30-28(24)22-9-3-1-4-10-22/h1-19H,20H2/b17-16+ |
| InChIKey | ZQCUPJBONFOBKF-WUKNDPDISA-N |
| XLogP | 5.84 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|