C20H23NO — CID 166082874
1-(1,2,2,4-tetramethyl-8-methylidene-9H-benzo[g]quinolin-7-yl)ethanone (PubChem CID 166082874) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(1,2,2,4-tetramethyl-8-methylidene-9H-benzo[g]quinolin-7-yl)ethanone.
| Compound Name | 1-(1,2,2,4-tetramethyl-8-methylidene-9H-benzo[g]quinolin-7-yl)ethanone |
|---|---|
| PubChem CID | 166082874 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-(1,2,2,4-tetramethyl-8-methylidene-9H-benzo[g]quinolin-7-yl)ethanone |
| SMILES | C=C1Cc2cc3c(cc2C=C1C(C)=O)C(C)=CC(C)(C)N3C |
| InChI | InChI=1S/C20H23NO/c1-12-7-15-10-19-18(9-16(15)8-17(12)14(3)22)13(2)11-20(4,5)21(19)6/h8-11H,1,7H2,2-6H3 |
| InChIKey | VRTRGCATNVOODW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|