C21H34FNO — CID 166084278
3-(4-cyclopropyl-2-fluorophenoxy)azetidine;ethane;(3Z)-penta-1,3-diene (PubChem CID 166084278) has the molecular formula C21H34FNO and a molecular weight of 335.51 g/mol. Its IUPAC name is 3-(4-cyclopropyl-2-fluorophenoxy)azetidine;ethane;(3Z)-penta-1,3-diene.
| Compound Name | 3-(4-cyclopropyl-2-fluorophenoxy)azetidine;ethane;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 166084278 |
| Molecular Formula | C21H34FNO |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 3-(4-cyclopropyl-2-fluorophenoxy)azetidine;ethane;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CC.CC.Fc1cc(C2CC2)ccc1OC1CNC1 |
| InChI | InChI=1S/C12H14FNO.C5H8.2C2H6/c13-11-5-9(8-1-2-8)3-4-12(11)15-10-6-14-7-10;1-3-5-4-2;2*1-2/h3-5,8,10,14H,1-2,6-7H2;3-5H,1H2,2H3;2*1-2H3/b;5-4-;; |
| InChIKey | BEZIHEUOQIUBRG-ZGVDEOGJSA-N |
| XLogP | 5.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|