C15H10BrF6NO2 — CID 166085643
2-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxy]-5-bromopyridine (PubChem CID 166085643) has the molecular formula C15H10BrF6NO2 and a molecular weight of 430.14 g/mol. Its IUPAC name is 2-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxy]-5-bromopyridine.
| Compound Name | 2-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxy]-5-bromopyridine |
|---|---|
| PubChem CID | 166085643 |
| Molecular Formula | C15H10BrF6NO2 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 2-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxy]-5-bromopyridine |
| SMILES | FC(F)(F)c1cc(OCCOc2ccc(Br)cn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10BrF6NO2/c16-11-1-2-13(23-8-11)25-4-3-24-12-6-9(14(17,18)19)5-10(7-12)15(20,21)22/h1-2,5-8H,3-4H2 |
| InChIKey | XKINKJJNAJTARO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|