C13H13BrN4O3 — CID 166085685
N'-amino-3-bromo-5-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzenecarboximidamide (PubChem CID 166085685) has the molecular formula C13H13BrN4O3 and a molecular weight of 353.18 g/mol. Its IUPAC name is N'-amino-3-bromo-5-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzenecarboximidamide.
| Compound Name | N'-amino-3-bromo-5-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 166085685 |
| Molecular Formula | C13H13BrN4O3 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | N'-amino-3-bromo-5-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzenecarboximidamide |
| SMILES | CCOc1c(Nc2cc(Br)cc(/C(N)=N/N)c2)c(=O)c1=O |
| InChI | InChI=1S/C13H13BrN4O3/c1-2-21-12-9(10(19)11(12)20)17-8-4-6(13(15)18-16)3-7(14)5-8/h3-5,17H,2,16H2,1H3,(H2,15,18) |
| InChIKey | HPQJPGHCUGHQFH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|