C27H32N6OS — CID 166091127
ethane;3-methyl-5-[1-[4-[2-(methylsulfanylamino)quinazolin-7-yl]pyrazol-1-yl]ethyl]-2-propoxybenzonitrile (PubChem CID 166091127) has the molecular formula C27H32N6OS and a molecular weight of 488.66 g/mol. Its IUPAC name is ethane;3-methyl-5-[1-[4-[2-(methylsulfanylamino)quinazolin-7-yl]pyrazol-1-yl]ethyl]-2-propoxybenzonitrile.
| Compound Name | ethane;3-methyl-5-[1-[4-[2-(methylsulfanylamino)quinazolin-7-yl]pyrazol-1-yl]ethyl]-2-propoxybenzonitrile |
|---|---|
| PubChem CID | 166091127 |
| Molecular Formula | C27H32N6OS |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | ethane;3-methyl-5-[1-[4-[2-(methylsulfanylamino)quinazolin-7-yl]pyrazol-1-yl]ethyl]-2-propoxybenzonitrile |
| SMILES | CC.CCCOc1c(C)cc(C(C)n2cc(-c3ccc4cnc(NSC)nc4c3)cn2)cc1C#N |
| InChI | InChI=1S/C25H26N6OS.C2H6/c1-5-8-32-24-16(2)9-20(10-21(24)12-26)17(3)31-15-22(14-28-31)18-6-7-19-13-27-25(30-33-4)29-23(19)11-18;1-2/h6-7,9-11,13-15,17H,5,8H2,1-4H3,(H,27,29,30);1-2H3 |
| InChIKey | IIVJVKYSRWSHNH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|