C23H25N3O — CID 166092004
[(9R)-6a-methyl-7-prop-2-ynyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone (PubChem CID 166092004) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is [(9R)-6a-methyl-7-prop-2-ynyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(9R)-6a-methyl-7-prop-2-ynyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 166092004 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [(9R)-6a-methyl-7-prop-2-ynyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C#CCN1C[C@H](C(=O)N2CCCC2)C=C2c3cccc4[nH]cc(c34)CC21C |
| InChI | InChI=1S/C23H25N3O/c1-3-9-26-15-16(22(27)25-10-4-5-11-25)12-19-18-7-6-8-20-21(18)17(14-24-20)13-23(19,26)2/h1,6-8,12,14,16,24H,4-5,9-11,13,15H2,2H3/t16-,23?/m1/s1 |
| InChIKey | XUEPZSQRZWVNCE-ADRQNKRLSA-N |
| XLogP | 3.05 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|