C12H18FN — CID 166097458
1-[(2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienyl]pyrrolidine (PubChem CID 166097458) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 1-[(2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienyl]pyrrolidine.
| Compound Name | 1-[(2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 166097458 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-[(2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienyl]pyrrolidine |
| SMILES | C=C/C(F)=C\C(=C/C)CN1CCCC1 |
| InChI | InChI=1S/C12H18FN/c1-3-11(9-12(13)4-2)10-14-7-5-6-8-14/h3-4,9H,2,5-8,10H2,1H3/b11-3+,12-9+ |
| InChIKey | PLJYXGBWFWIFJN-NLQSNWAZSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|