C21H22N4O2 — CID 166103396
1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenylpyrazin-2-yl)methyl]piperazine-2,3-dione (PubChem CID 166103396) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenylpyrazin-2-yl)methyl]piperazine-2,3-dione.
| Compound Name | 1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenylpyrazin-2-yl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103396 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-4-[(5-phenylpyrazin-2-yl)methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2C[C@@H]3C[C@@H]3C2)CCN1Cc1cnc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C21H22N4O2/c26-20-21(27)25(18-9-15-8-16(15)10-18)7-6-24(20)13-17-11-23-19(12-22-17)14-4-2-1-3-5-14/h1-5,11-12,15-16,18H,6-10,13H2/t15-,16+,18? |
| InChIKey | HADXYQSIINBMOF-BYICEURKSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|