C17H19N5O2S — CID 166103687
1-cyclopentyl-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione (PubChem CID 166103687) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-cyclopentyl-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103687 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-cyclopentyl-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCCC2)CCN1Cc1ccc(-c2nccs2)nn1 |
| InChI | InChI=1S/C17H19N5O2S/c23-16-17(24)22(13-3-1-2-4-13)9-8-21(16)11-12-5-6-14(20-19-12)15-18-7-10-25-15/h5-7,10,13H,1-4,8-9,11H2 |
| InChIKey | YMCUYNZTIAWMOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|