C16H21N7O2 — CID 166103798
1-cyclopentyl-4-[[6-(1,5-dihydrotriazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione (PubChem CID 166103798) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[6-(1,5-dihydrotriazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-cyclopentyl-4-[[6-(1,5-dihydrotriazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103798 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-cyclopentyl-4-[[6-(1,5-dihydrotriazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCCC2)CCN1Cc1ccc(N2N=CCN2)nn1 |
| InChI | InChI=1S/C16H21N7O2/c24-15-16(25)22(13-3-1-2-4-13)10-9-21(15)11-12-5-6-14(20-19-12)23-17-7-8-18-23/h5-7,13,18H,1-4,8-11H2 |
| InChIKey | OGUDTASJTBMPGU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|