C21H23N3O3 — CID 166103469
1-cyclopentyl-4-[(1-oxido-6-phenylpyridin-1-ium-3-yl)methyl]piperazine-2,3-dione (PubChem CID 166103469) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-cyclopentyl-4-[(1-oxido-6-phenylpyridin-1-ium-3-yl)methyl]piperazine-2,3-dione.
| Compound Name | 1-cyclopentyl-4-[(1-oxido-6-phenylpyridin-1-ium-3-yl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103469 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-cyclopentyl-4-[(1-oxido-6-phenylpyridin-1-ium-3-yl)methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCCC2)CCN1Cc1ccc(-c2ccccc2)[n+]([O-])c1 |
| InChI | InChI=1S/C21H23N3O3/c25-20-21(26)23(18-8-4-5-9-18)13-12-22(20)14-16-10-11-19(24(27)15-16)17-6-2-1-3-7-17/h1-3,6-7,10-11,15,18H,4-5,8-9,12-14H2 |
| InChIKey | SRJRIKBDSICIIQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|