C17H17FN4O2S — CID 166103626
1-cyclobutyl-4-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione (PubChem CID 166103626) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-cyclobutyl-4-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-cyclobutyl-4-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103626 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-cyclobutyl-4-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCC2)CCN1Cc1nnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H17FN4O2S/c18-12-6-4-11(5-7-12)15-20-19-14(25-15)10-21-8-9-22(13-2-1-3-13)17(24)16(21)23/h4-7,13H,1-3,8-10H2 |
| InChIKey | OBFRECTVCMSOBJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|