C17H21FN5O2PS — CID 166103515
cyclopropane;1-(2-fluorophosphanylethyl)-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione (PubChem CID 166103515) has the molecular formula C17H21FN5O2PS and a molecular weight of 409.43 g/mol. Its IUPAC name is cyclopropane;1-(2-fluorophosphanylethyl)-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione.
| Compound Name | cyclopropane;1-(2-fluorophosphanylethyl)-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 166103515 |
| Molecular Formula | C17H21FN5O2PS |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | cyclopropane;1-(2-fluorophosphanylethyl)-4-[[6-(1,3-thiazol-2-yl)pyridazin-3-yl]methyl]piperazine-2,3-dione |
| SMILES | C1CC1.O=C1C(=O)N(Cc2ccc(-c3nccs3)nn2)CCN1CCPF |
| InChI | InChI=1S/C14H15FN5O2PS.C3H6/c15-23-7-6-19-4-5-20(14(22)13(19)21)9-10-1-2-11(18-17-10)12-16-3-8-24-12;1-2-3-1/h1-3,8,23H,4-7,9H2;1-3H2 |
| InChIKey | XCCWUCYHEMJSFD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|