C24H22F6N2O3 — CID 166107492
(1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-methyl-2-(3,3,3-trifluoropropanoyl)-9-oxa-2,6-diazaspiro[4.5]decan-7-one (PubChem CID 166107492) has the molecular formula C24H22F6N2O3 and a molecular weight of 500.44 g/mol. Its IUPAC name is (1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-methyl-2-(3,3,3-trifluoropropanoyl)-9-oxa-2,6-diazaspiro[4.5]decan-7-one.
| Compound Name | (1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-methyl-2-(3,3,3-trifluoropropanoyl)-9-oxa-2,6-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 166107492 |
| Molecular Formula | C24H22F6N2O3 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-methyl-2-(3,3,3-trifluoropropanoyl)-9-oxa-2,6-diazaspiro[4.5]decan-7-one |
| SMILES | C[C@@H]1C[C@@]2(COCC(=O)N2)[C@H](Cc2cccc(-c3cc(F)cc(F)c3)c2F)N1C(=O)CC(F)(F)F |
| InChI | InChI=1S/C24H22F6N2O3/c1-13-9-23(12-35-11-20(33)31-23)19(32(13)21(34)10-24(28,29)30)7-14-3-2-4-18(22(14)27)15-5-16(25)8-17(26)6-15/h2-6,8,13,19H,7,9-12H2,1H3,(H,31,33)/t13-,19+,23-/m1/s1 |
| InChIKey | ZILUHNRWDIGNOP-DEWVYBRMSA-N |
| XLogP | 4.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |