C26H26F4N2O3 — CID 166107597
(1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(2-fluorocyclobutanecarbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one (PubChem CID 166107597) has the molecular formula C26H26F4N2O3 and a molecular weight of 490.50 g/mol. Its IUPAC name is (1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(2-fluorocyclobutanecarbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one.
| Compound Name | (1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(2-fluorocyclobutanecarbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 166107597 |
| Molecular Formula | C26H26F4N2O3 |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (1S,3R,5S)-1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(2-fluorocyclobutanecarbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one |
| SMILES | C[C@@H]1C[C@@]2(COCC(=O)N2)[C@H](Cc2cccc(-c3cc(F)cc(F)c3)c2F)N1C(=O)C1CCC1F |
| InChI | InChI=1S/C26H26F4N2O3/c1-14-11-26(13-35-12-23(33)31-26)22(32(14)25(34)20-5-6-21(20)29)9-15-3-2-4-19(24(15)30)16-7-17(27)10-18(28)8-16/h2-4,7-8,10,14,20-22H,5-6,9,11-13H2,1H3,(H,31,33)/t14-,20?,21?,22+,26-/m1/s1 |
| InChIKey | DACUNYWGKTZLJL-PGCLAUQBSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |