C24H23F4N3O3 — CID 166107696
1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-fluoroaziridine-2-carbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one (PubChem CID 166107696) has the molecular formula C24H23F4N3O3 and a molecular weight of 477.46 g/mol. Its IUPAC name is 1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-fluoroaziridine-2-carbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one.
| Compound Name | 1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-fluoroaziridine-2-carbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 166107696 |
| Molecular Formula | C24H23F4N3O3 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-fluoroaziridine-2-carbonyl)-3-methyl-9-oxa-2,6-diazaspiro[4.5]decan-7-one |
| SMILES | CC1CC2(COCC(=O)N2)C(Cc2cccc(-c3cc(F)cc(F)c3)c2F)N1C(=O)C1CN1F |
| InChI | InChI=1S/C24H23F4N3O3/c1-13-9-24(12-34-11-21(32)29-24)20(31(13)23(33)19-10-30(19)28)7-14-3-2-4-18(22(14)27)15-5-16(25)8-17(26)6-15/h2-6,8,13,19-20H,7,9-12H2,1H3,(H,29,32) |
| InChIKey | JGCXEJQRRFGDIB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|