C30H28F4N2O7S — CID 174263306
benzyl 1-[[2-fluoro-3-[2-(trifluoromethylsulfonyloxy)phenyl]phenyl]methyl]-3-methyl-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 174263306) has the molecular formula C30H28F4N2O7S and a molecular weight of 636.62 g/mol. Its IUPAC name is benzyl 1-[[2-fluoro-3-[2-(trifluoromethylsulfonyloxy)phenyl]phenyl]methyl]-3-methyl-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | benzyl 1-[[2-fluoro-3-[2-(trifluoromethylsulfonyloxy)phenyl]phenyl]methyl]-3-methyl-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 174263306 |
| Molecular Formula | C30H28F4N2O7S |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | benzyl 1-[[2-fluoro-3-[2-(trifluoromethylsulfonyloxy)phenyl]phenyl]methyl]-3-methyl-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC1CC2(COCC(=O)N2)C(Cc2cccc(-c3ccccc3OS(=O)(=O)C(F)(F)F)c2F)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H28F4N2O7S/c1-19-15-29(18-41-17-26(37)35-29)25(36(19)28(38)42-16-20-8-3-2-4-9-20)14-21-10-7-12-23(27(21)31)22-11-5-6-13-24(22)43-44(39,40)30(32,33)34/h2-13,19,25H,14-18H2,1H3,(H,35,37) |
| InChIKey | PAJDWMUFGYTFRP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|