C5H11NO — CID 166109571
(2S,5S)-5-methyloxolan-2-amine (PubChem CID 166109571) has the molecular formula C5H11NO and a molecular weight of 101.15 g/mol. Its IUPAC name is (2S,5S)-5-methyloxolan-2-amine.
| Compound Name | (2S,5S)-5-methyloxolan-2-amine |
|---|---|
| PubChem CID | 166109571 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | (2S,5S)-5-methyloxolan-2-amine |
| SMILES | C[C@H]1CC[C@@H](N)O1 |
| InChI | InChI=1S/C5H11NO/c1-4-2-3-5(6)7-4/h4-5H,2-3,6H2,1H3/t4-,5-/m0/s1 |
| InChIKey | YGGIIXBFGPDEHZ-WHFBIAKZSA-N |
| XLogP | 0.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |