C28H19ClF3N5O4 — CID 166111540
3-[1-[2-[(E)-1-amino-3-(4-cyanophenyl)iminoprop-1-en-2-yl]-4-oxo-6-(trifluoromethyl)chromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid (PubChem CID 166111540) has the molecular formula C28H19ClF3N5O4 and a molecular weight of 581.94 g/mol. Its IUPAC name is 3-[1-[2-[(E)-1-amino-3-(4-cyanophenyl)iminoprop-1-en-2-yl]-4-oxo-6-(trifluoromethyl)chromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid.
| Compound Name | 3-[1-[2-[(E)-1-amino-3-(4-cyanophenyl)iminoprop-1-en-2-yl]-4-oxo-6-(trifluoromethyl)chromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166111540 |
| Molecular Formula | C28H19ClF3N5O4 |
| Molecular Weight | 581.94 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 3-[1-[2-[(E)-1-amino-3-(4-cyanophenyl)iminoprop-1-en-2-yl]-4-oxo-6-(trifluoromethyl)chromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
| SMILES | CC(Nc1ccc(Cl)nc1C(=O)O)c1cc(C(F)(F)F)cc2c(=O)cc(C(/C=N/c3ccc(C#N)cc3)=C/N)oc12 |
| InChI | InChI=1S/C28H19ClF3N5O4/c1-14(36-21-6-7-24(29)37-25(21)27(39)40)19-8-17(28(30,31)32)9-20-22(38)10-23(41-26(19)20)16(12-34)13-35-18-4-2-15(11-33)3-5-18/h2-10,12-14,36H,34H2,1H3,(H,39,40)/b16-12+,35-13+ |
| InChIKey | ZVURRKZYGICQLY-AHKSFCMWSA-N |
| XLogP | 6.31 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.94 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|