C28H20F6N4OS — CID 166120202
2-pyridin-2-yl-N-[3-[4-[4-(trifluoromethoxy)phenyl]phenyl]propyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 166120202) has the molecular formula C28H20F6N4OS and a molecular weight of 574.55 g/mol. Its IUPAC name is 2-pyridin-2-yl-N-[3-[4-[4-(trifluoromethoxy)phenyl]phenyl]propyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-pyridin-2-yl-N-[3-[4-[4-(trifluoromethoxy)phenyl]phenyl]propyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166120202 |
| Molecular Formula | C28H20F6N4OS |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 2-pyridin-2-yl-N-[3-[4-[4-(trifluoromethoxy)phenyl]phenyl]propyl]-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc(CCCNc3nc(-c4ccccn4)nc4sc(C(F)(F)F)cc34)cc2)cc1 |
| InChI | InChI=1S/C28H20F6N4OS/c29-27(30,31)23-16-21-24(37-25(38-26(21)40-23)22-5-1-2-14-35-22)36-15-3-4-17-6-8-18(9-7-17)19-10-12-20(13-11-19)39-28(32,33)34/h1-2,5-14,16H,3-4,15H2,(H,36,37,38) |
| InChIKey | AQIMDRVCXXZJRG-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|