C16H19IN2O — CID 166123054
1-benzyl-4-[(2R,6R)-4-iodo-6-methyloxan-2-yl]pyrazole (PubChem CID 166123054) has the molecular formula C16H19IN2O and a molecular weight of 382.25 g/mol. Its IUPAC name is 1-benzyl-4-[(2R,6R)-4-iodo-6-methyloxan-2-yl]pyrazole.
| Compound Name | 1-benzyl-4-[(2R,6R)-4-iodo-6-methyloxan-2-yl]pyrazole |
|---|---|
| PubChem CID | 166123054 |
| Molecular Formula | C16H19IN2O |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 1-benzyl-4-[(2R,6R)-4-iodo-6-methyloxan-2-yl]pyrazole |
| SMILES | C[C@@H]1CC(I)C[C@H](c2cnn(Cc3ccccc3)c2)O1 |
| InChI | InChI=1S/C16H19IN2O/c1-12-7-15(17)8-16(20-12)14-9-18-19(11-14)10-13-5-3-2-4-6-13/h2-6,9,11-12,15-16H,7-8,10H2,1H3/t12-,15?,16-/m1/s1 |
| InChIKey | HZLDLWCKKHNQAF-IATLWXBXSA-N |
| XLogP | 3.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|