C19H18BN3OS — CID 166128177
4-[3-(2-hydroxyphenyl)-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile (PubChem CID 166128177) has the molecular formula C19H18BN3OS and a molecular weight of 347.25 g/mol. Its IUPAC name is 4-[3-(2-hydroxyphenyl)-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile.
| Compound Name | 4-[3-(2-hydroxyphenyl)-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile |
|---|---|
| PubChem CID | 166128177 |
| Molecular Formula | C19H18BN3OS |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[3-(2-hydroxyphenyl)-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile |
| SMILES | Cc1c(C2CCB(C#N)CC2)sc2nnc(-c3ccccc3O)cc12 |
| InChI | InChI=1S/C19H18BN3OS/c1-12-15-10-16(14-4-2-3-5-17(14)24)22-23-19(15)25-18(12)13-6-8-20(11-21)9-7-13/h2-5,10,13,24H,6-9H2,1H3 |
| InChIKey | BXVUGEISNWBNBF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|