C20H27N — CID 166131639
1-(2-tert-butylphenyl)-N-[(4Z)-4-methyl-3-methylidenehexa-1,4-dien-2-yl]ethanimine (PubChem CID 166131639) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-N-[(4Z)-4-methyl-3-methylidenehexa-1,4-dien-2-yl]ethanimine.
| Compound Name | 1-(2-tert-butylphenyl)-N-[(4Z)-4-methyl-3-methylidenehexa-1,4-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 166131639 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-(2-tert-butylphenyl)-N-[(4Z)-4-methyl-3-methylidenehexa-1,4-dien-2-yl]ethanimine |
| SMILES | C=C(/N=C(\C)c1ccccc1C(C)(C)C)C(=C)/C(C)=C\C |
| InChI | InChI=1S/C20H27N/c1-9-14(2)15(3)16(4)21-17(5)18-12-10-11-13-19(18)20(6,7)8/h9-13H,3-4H2,1-2,5-8H3/b14-9-,21-17+ |
| InChIKey | FJKDILFYBMNLQY-NLNXUYBSSA-N |
| XLogP | 5.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|