C18H28N2 — CID 91254389
3-[2-(C,N-dimethylcarbonimidoyl)phenyl]-N,3-dimethyl-N-prop-1-en-2-ylbutan-1-amine (PubChem CID 91254389) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-[2-(C,N-dimethylcarbonimidoyl)phenyl]-N,3-dimethyl-N-prop-1-en-2-ylbutan-1-amine.
| Compound Name | 3-[2-(C,N-dimethylcarbonimidoyl)phenyl]-N,3-dimethyl-N-prop-1-en-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 91254389 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 3-[2-(C,N-dimethylcarbonimidoyl)phenyl]-N,3-dimethyl-N-prop-1-en-2-ylbutan-1-amine |
| SMILES | C=C(C)N(C)CCC(C)(C)c1ccccc1/C(C)=N/C |
| InChI | InChI=1S/C18H28N2/c1-14(2)20(7)13-12-18(4,5)17-11-9-8-10-16(17)15(3)19-6/h8-11H,1,12-13H2,2-7H3/b19-15+ |
| InChIKey | OCTCMLHOQSPVJR-XDJHFCHBSA-N |
| XLogP | 4.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|